C11H11BrN2O2S — CID 63334680
N-(3-bromo-4-methylphenyl)-2-oxo-1,3-thiazolidine-4-carboxamide (PubChem CID 63334680) has the molecular formula C11H11BrN2O2S and a molecular weight of 315.19 g/mol. Its IUPAC name is N-(3-bromo-4-methylphenyl)-2-oxo-1,3-thiazolidine-4-carboxamide.
| Compound Name | N-(3-bromo-4-methylphenyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 63334680 |
| Molecular Formula | C11H11BrN2O2S |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 313.97 |
| IUPAC Name | N-(3-bromo-4-methylphenyl)-2-oxo-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CSC(=O)N2)cc1Br |
| InChI | InChI=1S/C11H11BrN2O2S/c1-6-2-3-7(4-8(6)12)13-10(15)9-5-17-11(16)14-9/h2-4,9H,5H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | QXMITZQFPPKCCG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|