C10H11N3O4S2 — CID 61131241
2-oxo-N-(3-sulfamoylphenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 61131241) has the molecular formula C10H11N3O4S2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-oxo-N-(3-sulfamoylphenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 2-oxo-N-(3-sulfamoylphenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 61131241 |
| Molecular Formula | C10H11N3O4S2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2-oxo-N-(3-sulfamoylphenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)C2CSC(=O)N2)c1 |
| InChI | InChI=1S/C10H11N3O4S2/c11-19(16,17)7-3-1-2-6(4-7)12-9(14)8-5-18-10(15)13-8/h1-4,8H,5H2,(H,12,14)(H,13,15)(H2,11,16,17) |
| InChIKey | QKGJGLNXGQYFPN-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|