C12H18N4O3S — CID 63101675
5-methyl-N-(3-sulfamoylphenyl)piperazine-2-carboxamide (PubChem CID 63101675) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is 5-methyl-N-(3-sulfamoylphenyl)piperazine-2-carboxamide.
| Compound Name | 5-methyl-N-(3-sulfamoylphenyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 63101675 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 5-methyl-N-(3-sulfamoylphenyl)piperazine-2-carboxamide |
| SMILES | CC1CNC(C(=O)Nc2cccc(S(N)(=O)=O)c2)CN1 |
| InChI | InChI=1S/C12H18N4O3S/c1-8-6-15-11(7-14-8)12(17)16-9-3-2-4-10(5-9)20(13,18)19/h2-5,8,11,14-15H,6-7H2,1H3,(H,16,17)(H2,13,18,19) |
| InChIKey | FEUUJHRDLBYBBU-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |