C16H25N3O — CID 63102745
N-(2,6-diethylphenyl)-5-methylpiperazine-2-carboxamide (PubChem CID 63102745) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-5-methylpiperazine-2-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)-5-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 63102745 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | N-(2,6-diethylphenyl)-5-methylpiperazine-2-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C1CNC(C)CN1 |
| InChI | InChI=1S/C16H25N3O/c1-4-12-7-6-8-13(5-2)15(12)19-16(20)14-10-17-11(3)9-18-14/h6-8,11,14,17-18H,4-5,9-10H2,1-3H3,(H,19,20) |
| InChIKey | CRAXWZNTYMOLAF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |