C15H21N3O2 — CID 107433398
N-(2,6-diethylphenyl)-5-oxopiperazine-2-carboxamide (PubChem CID 107433398) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-(2,6-diethylphenyl)-5-oxopiperazine-2-carboxamide.
| Compound Name | N-(2,6-diethylphenyl)-5-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 107433398 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | N-(2,6-diethylphenyl)-5-oxopiperazine-2-carboxamide |
| SMILES | CCc1cccc(CC)c1NC(=O)C1CNC(=O)CN1 |
| InChI | InChI=1S/C15H21N3O2/c1-3-10-6-5-7-11(4-2)14(10)18-15(20)12-8-17-13(19)9-16-12/h5-7,12,16H,3-4,8-9H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | ASHGWUYTUSUJHA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |