C10H11ClN4O2 — CID 107437364
N-(6-chloro-2-pyridinyl)-5-oxopiperazine-2-carboxamide (PubChem CID 107437364) has the molecular formula C10H11ClN4O2 and a molecular weight of 254.68 g/mol. Its IUPAC name is N-(6-chloro-2-pyridinyl)-5-oxopiperazine-2-carboxamide.
| Compound Name | N-(6-chloro-2-pyridinyl)-5-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 107437364 |
| Molecular Formula | C10H11ClN4O2 |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | N-(6-chloro-2-pyridinyl)-5-oxopiperazine-2-carboxamide |
| SMILES | O=C1CNC(C(=O)Nc2cccc(Cl)n2)CN1 |
| InChI | InChI=1S/C10H11ClN4O2/c11-7-2-1-3-8(14-7)15-10(17)6-4-13-9(16)5-12-6/h1-3,6,12H,4-5H2,(H,13,16)(H,14,15,17) |
| InChIKey | FOJGIUFJCIBYCE-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|