C13H15N3O4 — CID 107433947
methyl 2-[(5-oxopiperazine-2-carbonyl)amino]benzoate (PubChem CID 107433947) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is methyl 2-[(5-oxopiperazine-2-carbonyl)amino]benzoate.
| Compound Name | methyl 2-[(5-oxopiperazine-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 107433947 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | methyl 2-[(5-oxopiperazine-2-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C1CNC(=O)CN1 |
| InChI | InChI=1S/C13H15N3O4/c1-20-13(19)8-4-2-3-5-9(8)16-12(18)10-6-15-11(17)7-14-10/h2-5,10,14H,6-7H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | RIWKHXNTZXRFAA-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |