C12H13F2N3O2S — CID 107433437
N-[2-(difluoromethylsulfanyl)phenyl]-5-oxopiperazine-2-carboxamide (PubChem CID 107433437) has the molecular formula C12H13F2N3O2S and a molecular weight of 301.32 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-5-oxopiperazine-2-carboxamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-5-oxopiperazine-2-carboxamide |
|---|---|
| PubChem CID | 107433437 |
| Molecular Formula | C12H13F2N3O2S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-5-oxopiperazine-2-carboxamide |
| SMILES | O=C1CNC(C(=O)Nc2ccccc2SC(F)F)CN1 |
| InChI | InChI=1S/C12H13F2N3O2S/c13-12(14)20-9-4-2-1-3-7(9)17-11(19)8-5-16-10(18)6-15-8/h1-4,8,12,15H,5-6H2,(H,16,18)(H,17,19) |
| InChIKey | MXYHTMHSTLZRLV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |