C13H14F2N2O2S — CID 112729117
N-[2-(difluoromethylsulfanyl)phenyl]-6-oxopiperidine-3-carboxamide (PubChem CID 112729117) has the molecular formula C13H14F2N2O2S and a molecular weight of 300.33 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 112729117 |
| Molecular Formula | C13H14F2N2O2S |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-6-oxopiperidine-3-carboxamide |
| SMILES | O=C1CCC(C(=O)Nc2ccccc2SC(F)F)CN1 |
| InChI | InChI=1S/C13H14F2N2O2S/c14-13(15)20-10-4-2-1-3-9(10)17-12(19)8-5-6-11(18)16-7-8/h1-4,8,13H,5-7H2,(H,16,18)(H,17,19) |
| InChIKey | GVNASGPRRPKXNL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |