C16H22N2O2 — CID 76871965
N-(2-tert-butylphenyl)-6-oxopiperidine-3-carboxamide (PubChem CID 76871965) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | N-(2-tert-butylphenyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 76871965 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | N-(2-tert-butylphenyl)-6-oxopiperidine-3-carboxamide |
| SMILES | CC(C)(C)c1ccccc1NC(=O)C1CCC(=O)NC1 |
| InChI | InChI=1S/C16H22N2O2/c1-16(2,3)12-6-4-5-7-13(12)18-15(20)11-8-9-14(19)17-10-11/h4-7,11H,8-10H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | BYNCSXZISBESAP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |