C13H13F3N2O2S — CID 76871986
6-oxo-N-[4-(trifluoromethylsulfanyl)phenyl]piperidine-3-carboxamide (PubChem CID 76871986) has the molecular formula C13H13F3N2O2S and a molecular weight of 318.32 g/mol. Its IUPAC name is 6-oxo-N-[4-(trifluoromethylsulfanyl)phenyl]piperidine-3-carboxamide.
| Compound Name | 6-oxo-N-[4-(trifluoromethylsulfanyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 76871986 |
| Molecular Formula | C13H13F3N2O2S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | 6-oxo-N-[4-(trifluoromethylsulfanyl)phenyl]piperidine-3-carboxamide |
| SMILES | O=C1CCC(C(=O)Nc2ccc(SC(F)(F)F)cc2)CN1 |
| InChI | InChI=1S/C13H13F3N2O2S/c14-13(15,16)21-10-4-2-9(3-5-10)18-12(20)8-1-6-11(19)17-7-8/h2-5,8H,1,6-7H2,(H,17,19)(H,18,20) |
| InChIKey | KGIGKIQRXBRNMW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |