C13H14N4O2S — CID 99591065
(3S)-6-oxo-N-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)piperidine-3-carboxamide (PubChem CID 99591065) has the molecular formula C13H14N4O2S and a molecular weight of 290.35 g/mol. Its IUPAC name is (3S)-6-oxo-N-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-6-oxo-N-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 99591065 |
| Molecular Formula | C13H14N4O2S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | (3S)-6-oxo-N-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)piperidine-3-carboxamide |
| SMILES | O=C1CC[C@H](C(=O)Nc2ccc3[nH]c(=S)[nH]c3c2)CN1 |
| InChI | InChI=1S/C13H14N4O2S/c18-11-4-1-7(6-14-11)12(19)15-8-2-3-9-10(5-8)17-13(20)16-9/h2-3,5,7H,1,4,6H2,(H,14,18)(H,15,19)(H2,16,17,20)/t7-/m0/s1 |
| InChIKey | PJGFMVIWHQBVHK-ZETCQYMHSA-N |
| XLogP | 1.69 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|