C12H12N4O2S — CID 99637421
(2R)-5-oxo-N-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)pyrrolidine-2-carboxamide (PubChem CID 99637421) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is (2R)-5-oxo-N-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2R)-5-oxo-N-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 99637421 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | (2R)-5-oxo-N-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)pyrrolidine-2-carboxamide |
| SMILES | O=C1CC[C@H](C(=O)Nc2ccc3[nH]c(=S)[nH]c3c2)N1 |
| InChI | InChI=1S/C12H12N4O2S/c17-10-4-3-8(14-10)11(18)13-6-1-2-7-9(5-6)16-12(19)15-7/h1-2,5,8H,3-4H2,(H,13,18)(H,14,17)(H2,15,16,19)/t8-/m1/s1 |
| InChIKey | YNQNMIXQCACEGH-MRVPVSSYSA-N |
| XLogP | 1.44 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|