C11H10Cl2N2O2 — CID 26469933
(2S)-N-(3,5-dichlorophenyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 26469933) has the molecular formula C11H10Cl2N2O2 and a molecular weight of 273.12 g/mol. Its IUPAC name is (2S)-N-(3,5-dichlorophenyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(3,5-dichlorophenyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 26469933 |
| Molecular Formula | C11H10Cl2N2O2 |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 272.01 |
| IUPAC Name | (2S)-N-(3,5-dichlorophenyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C1CC[C@@H](C(=O)Nc2cc(Cl)cc(Cl)c2)N1 |
| InChI | InChI=1S/C11H10Cl2N2O2/c12-6-3-7(13)5-8(4-6)14-11(17)9-1-2-10(16)15-9/h3-5,9H,1-2H2,(H,14,17)(H,15,16)/t9-/m0/s1 |
| InChIKey | YUGUPSLNMWLMIL-VIFPVBQESA-N |
| XLogP | 2.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |