C11H10Cl2N2O3 — CID 103891199
(2R)-N-(3,5-dichloro-2-hydroxyphenyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 103891199) has the molecular formula C11H10Cl2N2O3 and a molecular weight of 289.12 g/mol. Its IUPAC name is (2R)-N-(3,5-dichloro-2-hydroxyphenyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-(3,5-dichloro-2-hydroxyphenyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 103891199 |
| Molecular Formula | C11H10Cl2N2O3 |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | (2R)-N-(3,5-dichloro-2-hydroxyphenyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C1CC[C@H](C(=O)Nc2cc(Cl)cc(Cl)c2O)N1 |
| InChI | InChI=1S/C11H10Cl2N2O3/c12-5-3-6(13)10(17)8(4-5)15-11(18)7-1-2-9(16)14-7/h3-4,7,17H,1-2H2,(H,14,16)(H,15,18)/t7-/m1/s1 |
| InChIKey | NOZVNTLOSIMHBS-SSDOTTSWSA-N |
| XLogP | 1.92 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|