C12H12Cl2N2O2 — CID 132530671
(2S)-N-[(2,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 132530671) has the molecular formula C12H12Cl2N2O2 and a molecular weight of 287.15 g/mol. Its IUPAC name is (2S)-N-[(2,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 132530671 |
| Molecular Formula | C12H12Cl2N2O2 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | (2S)-N-[(2,4-dichlorophenyl)methyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C1CC[C@@H](C(=O)NCc2ccc(Cl)cc2Cl)N1 |
| InChI | InChI=1S/C12H12Cl2N2O2/c13-8-2-1-7(9(14)5-8)6-15-12(18)10-3-4-11(17)16-10/h1-2,5,10H,3-4,6H2,(H,15,18)(H,16,17)/t10-/m0/s1 |
| InChIKey | JZIGGCUPZSGUSI-JTQLQIEISA-N |
| XLogP | 1.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |