C14H16Cl2N2O3 — CID 95040802
(2S)-N-[3-(2,4-dichlorophenoxy)propyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 95040802) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is (2S)-N-[3-(2,4-dichlorophenoxy)propyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[3-(2,4-dichlorophenoxy)propyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 95040802 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | (2S)-N-[3-(2,4-dichlorophenoxy)propyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C1CC[C@@H](C(=O)NCCCOc2ccc(Cl)cc2Cl)N1 |
| InChI | InChI=1S/C14H16Cl2N2O3/c15-9-2-4-12(10(16)8-9)21-7-1-6-17-14(20)11-3-5-13(19)18-11/h2,4,8,11H,1,3,5-7H2,(H,17,20)(H,18,19)/t11-/m0/s1 |
| InChIKey | DONINYQQXUMGIV-NSHDSACASA-N |
| XLogP | 2.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|