C10H18N2O3 — CID 107319131
N-(5-hydroxypentyl)-5-oxopyrrolidine-2-carboxamide (PubChem CID 107319131) has the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-(5-hydroxypentyl)-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 107319131 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | N-(5-hydroxypentyl)-5-oxopyrrolidine-2-carboxamide |
| SMILES | O=C1CCC(C(=O)NCCCCCO)N1 |
| InChI | InChI=1S/C10H18N2O3/c13-7-3-1-2-6-11-10(15)8-4-5-9(14)12-8/h8,13H,1-7H2,(H,11,15)(H,12,14) |
| InChIKey | MRLZWQJQWUNSDU-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|