C14H23N5O4 — CID 155810723
5-oxo-N-[2-[2-[(5-oxopyrrolidine-2-carbonyl)amino]ethylamino]ethyl]pyrrolidine-2-carboxamide (PubChem CID 155810723) has the molecular formula C14H23N5O4 and a molecular weight of 325.37 g/mol. Its IUPAC name is 5-oxo-N-[2-[2-[(5-oxopyrrolidine-2-carbonyl)amino]ethylamino]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | 5-oxo-N-[2-[2-[(5-oxopyrrolidine-2-carbonyl)amino]ethylamino]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 155810723 |
| Molecular Formula | C14H23N5O4 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 5-oxo-N-[2-[2-[(5-oxopyrrolidine-2-carbonyl)amino]ethylamino]ethyl]pyrrolidine-2-carboxamide |
| SMILES | O=C1CCC(C(=O)NCCNCCNC(=O)C2CCC(=O)N2)N1 |
| InChI | InChI=1S/C14H23N5O4/c20-11-3-1-9(18-11)13(22)16-7-5-15-6-8-17-14(23)10-2-4-12(21)19-10/h9-10,15H,1-8H2,(H,16,22)(H,17,23)(H,18,20)(H,19,21) |
| InChIKey | JTNACGBRVNBZTP-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 128.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|