C8H15N3O2 — CID 94537622
(2S)-N-[2-(methylamino)ethyl]-5-oxopyrrolidine-2-carboxamide (PubChem CID 94537622) has the molecular formula C8H15N3O2 and a molecular weight of 185.23 g/mol. Its IUPAC name is (2S)-N-[2-(methylamino)ethyl]-5-oxopyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[2-(methylamino)ethyl]-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 94537622 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (2S)-N-[2-(methylamino)ethyl]-5-oxopyrrolidine-2-carboxamide |
| SMILES | CNCCNC(=O)[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C8H15N3O2/c1-9-4-5-10-8(13)6-2-3-7(12)11-6/h6,9H,2-5H2,1H3,(H,10,13)(H,11,12)/t6-/m0/s1 |
| InChIKey | VWZVXAJKHVNPCD-LURJTMIESA-N |
| XLogP | -1.40 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|