C17H21Cl2NO4 — CID 120673180
4-[3-(2,4-dichlorophenoxy)propylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 120673180) has the molecular formula C17H21Cl2NO4 and a molecular weight of 374.26 g/mol. Its IUPAC name is 4-[3-(2,4-dichlorophenoxy)propylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-(2,4-dichlorophenoxy)propylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120673180 |
| Molecular Formula | C17H21Cl2NO4 |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 4-[3-(2,4-dichlorophenoxy)propylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)NCCCOc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H21Cl2NO4/c18-13-6-7-15(14(19)10-13)24-9-1-8-20-16(21)11-2-4-12(5-3-11)17(22)23/h6-7,10-12H,1-5,8-9H2,(H,20,21)(H,22,23) |
| InChIKey | LMEFXJSTLLJGNF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|