C20H20Cl2N2O3 — CID 38324971
N-[3-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl]cyclopropanecarboxamide (PubChem CID 38324971) has the molecular formula C20H20Cl2N2O3 and a molecular weight of 407.30 g/mol. Its IUPAC name is N-[3-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 38324971 |
| Molecular Formula | C20H20Cl2N2O3 |
| Molecular Weight | 407.30 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | N-[3-[4-(2,4-dichlorophenoxy)butanoylamino]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)Nc1cccc(NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C20H20Cl2N2O3/c21-14-8-9-18(17(22)11-14)27-10-2-5-19(25)23-15-3-1-4-16(12-15)24-20(26)13-6-7-13/h1,3-4,8-9,11-13H,2,5-7,10H2,(H,23,25)(H,24,26) |
| InChIKey | GYTBDAUXPVXESJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.30 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|