About N-[3-(2,4-dichlorophenoxy)propyl]-2-(2-methoxyethylamino)acetamide;hydrochloride
N-[3-(2,4-dichlorophenoxy)propyl]-2-(2-methoxyethylamino)acetamide;hydrochloride (PubChem CID 119754516) has the molecular formula C14H21Cl3N2O3
and a molecular weight of 371.69 g/mol. Its IUPAC name is N-[3-(2,4-dichlorophenoxy)propyl]-2-(2-methoxyethylamino)acetamide;hydrochloride.
Molecular Properties
| Compound Name | N-[3-(2,4-dichlorophenoxy)propyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
| PubChem CID | 119754516 |
| Molecular Formula | C14H21Cl3N2O3 |
| Molecular Weight | 371.69 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | N-[3-(2,4-dichlorophenoxy)propyl]-2-(2-methoxyethylamino)acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NCCCOc1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C14H20Cl2N2O3.ClH/c1-20-8-6-17-10-14(19)18-5-2-7-21-13-4-3-11(15)9-12(13)16;/h3-4,9,17H,2,5-8,10H2,1H3,(H,18,19);1H |
| InChIKey | IIOPTRGRFMXAPB-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.69 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(2,4-dichlorophenoxy)propyl]-2-(2-methoxyethylamino)acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2,4-dichlorophenoxy)propyl]-2-(2-methoxyethylamino)acetamide;hydrochloride?
The IUPAC name of N-[3-(2,4-dichlorophenoxy)propyl]-2-(2-methoxyethylamino)acetamide;hydrochloride (CID 119754516) is N-[3-(2,4-dichlorophenoxy)propyl]-2-(2-methoxyethylamino)acetamide;hydrochloride.
What is the SMILES notation for N-[3-(2,4-dichlorophenoxy)propyl]-2-(2-methoxyethylamino)acetamide;hydrochloride?
The canonical SMILES for N-[3-(2,4-dichlorophenoxy)propyl]-2-(2-methoxyethylamino)acetamide;hydrochloride is COCCNCC(=O)NCCCOc1ccc(Cl)cc1Cl.Cl.
What is the InChIKey of N-[3-(2,4-dichlorophenoxy)propyl]-2-(2-methoxyethylamino)acetamide;hydrochloride?
The InChIKey is IIOPTRGRFMXAPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20Cl2N2O3.ClH/c1-20-8-6-17-10-14(19)18-5-2-7-21-13-4-3-11(15)9-12(13)16;/h3-4,9,17H,2,5-8,10H2,1H3,(H,18,19);1H.
What are the key properties of N-[3-(2,4-dichlorophenoxy)propyl]-2-(2-methoxyethylamino)acetamide;hydrochloride?
N-[3-(2,4-dichlorophenoxy)propyl]-2-(2-methoxyethylamino)acetamide;hydrochloride has a molecular weight of 371.69 g/mol, XLogP of 2.54, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2,4-dichlorophenoxy)propyl]-2-(2-methoxyethylamino)acetamide;hydrochloride is sourced from PubChem (CID 119754516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).