C14H21Cl3N2O2 — CID 120561480
4-amino-N-[3-(2,4-dichlorophenoxy)propyl]pentanamide;hydrochloride (PubChem CID 120561480) has the molecular formula C14H21Cl3N2O2 and a molecular weight of 355.69 g/mol. Its IUPAC name is 4-amino-N-[3-(2,4-dichlorophenoxy)propyl]pentanamide;hydrochloride.
| Compound Name | 4-amino-N-[3-(2,4-dichlorophenoxy)propyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120561480 |
| Molecular Formula | C14H21Cl3N2O2 |
| Molecular Weight | 355.69 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 4-amino-N-[3-(2,4-dichlorophenoxy)propyl]pentanamide;hydrochloride |
| SMILES | CC(N)CCC(=O)NCCCOc1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C14H20Cl2N2O2.ClH/c1-10(17)3-6-14(19)18-7-2-8-20-13-5-4-11(15)9-12(13)16;/h4-5,9-10H,2-3,6-8,17H2,1H3,(H,18,19);1H |
| InChIKey | BQEMUNDBGSQWTK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.69 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|