C14H21Cl3N2O2S — CID 119306639
(2S)-2-amino-N-[3-(2,4-dichlorophenoxy)propyl]-4-methylsulfanylbutanamide;hydrochloride (PubChem CID 119306639) has the molecular formula C14H21Cl3N2O2S and a molecular weight of 387.76 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-(2,4-dichlorophenoxy)propyl]-4-methylsulfanylbutanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-[3-(2,4-dichlorophenoxy)propyl]-4-methylsulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119306639 |
| Molecular Formula | C14H21Cl3N2O2S |
| Molecular Weight | 387.76 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | (2S)-2-amino-N-[3-(2,4-dichlorophenoxy)propyl]-4-methylsulfanylbutanamide;hydrochloride |
| SMILES | CSCC[C@H](N)C(=O)NCCCOc1ccc(Cl)cc1Cl.Cl |
| InChI | InChI=1S/C14H20Cl2N2O2S.ClH/c1-21-8-5-12(17)14(19)18-6-2-7-20-13-4-3-10(15)9-11(13)16;/h3-4,9,12H,2,5-8,17H2,1H3,(H,18,19);1H/t12-;/m0./s1 |
| InChIKey | LGAOSCGFMRQQGV-YDALLXLXSA-N |
| XLogP | 3.38 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.76 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|