C12H19Cl4N3O2S — CID 119900821
(2S)-2-amino-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-4-methylsulfanylbutanamide;dihydrochloride (PubChem CID 119900821) has the molecular formula C12H19Cl4N3O2S and a molecular weight of 411.18 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-4-methylsulfanylbutanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-4-methylsulfanylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119900821 |
| Molecular Formula | C12H19Cl4N3O2S |
| Molecular Weight | 411.18 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | (2S)-2-amino-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-4-methylsulfanylbutanamide;dihydrochloride |
| SMILES | CSCC[C@H](N)C(=O)NCCOc1ncc(Cl)cc1Cl.Cl.Cl |
| InChI | InChI=1S/C12H17Cl2N3O2S.2ClH/c1-20-5-2-10(15)11(18)16-3-4-19-12-9(14)6-8(13)7-17-12;;/h6-7,10H,2-5,15H2,1H3,(H,16,18);2*1H/t10-;;/m0../s1 |
| InChIKey | HGQRHCZZTAQQPG-XRIOVQLTSA-N |
| XLogP | 2.81 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|