C10H13Cl2N3O2 — CID 119900842
2-amino-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]propanamide (PubChem CID 119900842) has the molecular formula C10H13Cl2N3O2 and a molecular weight of 278.14 g/mol. Its IUPAC name is 2-amino-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]propanamide.
| Compound Name | 2-amino-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]propanamide |
|---|---|
| PubChem CID | 119900842 |
| Molecular Formula | C10H13Cl2N3O2 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-amino-N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]propanamide |
| SMILES | CC(N)C(=O)NCCOc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C10H13Cl2N3O2/c1-6(13)9(16)14-2-3-17-10-8(12)4-7(11)5-15-10/h4-6H,2-3,13H2,1H3,(H,14,16) |
| InChIKey | NPCKIBBYWBFHGR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|