C15H14Cl2N2O3 — CID 71917205
N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-2-(2-hydroxyphenyl)acetamide (PubChem CID 71917205) has the molecular formula C15H14Cl2N2O3 and a molecular weight of 341.19 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-2-(2-hydroxyphenyl)acetamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-2-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 71917205 |
| Molecular Formula | C15H14Cl2N2O3 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-2-(2-hydroxyphenyl)acetamide |
| SMILES | O=C(Cc1ccccc1O)NCCOc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C15H14Cl2N2O3/c16-11-8-12(17)15(19-9-11)22-6-5-18-14(21)7-10-3-1-2-4-13(10)20/h1-4,8-9,20H,5-7H2,(H,18,21) |
| InChIKey | NMUYPQCYRLCGAE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|