C21H19Cl2N3O3 — CID 60536795
2-[2-[(3,5-dichloro-2-pyridinyl)oxy]anilino]-N-(2-phenoxyethyl)acetamide (PubChem CID 60536795) has the molecular formula C21H19Cl2N3O3 and a molecular weight of 432.31 g/mol. Its IUPAC name is 2-[2-[(3,5-dichloro-2-pyridinyl)oxy]anilino]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[2-[(3,5-dichloro-2-pyridinyl)oxy]anilino]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 60536795 |
| Molecular Formula | C21H19Cl2N3O3 |
| Molecular Weight | 432.31 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 2-[2-[(3,5-dichloro-2-pyridinyl)oxy]anilino]-N-(2-phenoxyethyl)acetamide |
| SMILES | O=C(CNc1ccccc1Oc1ncc(Cl)cc1Cl)NCCOc1ccccc1 |
| InChI | InChI=1S/C21H19Cl2N3O3/c22-15-12-17(23)21(26-13-15)29-19-9-5-4-8-18(19)25-14-20(27)24-10-11-28-16-6-2-1-3-7-16/h1-9,12-13,25H,10-11,14H2,(H,24,27) |
| InChIKey | IZQCXRNFHOJNNN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|