C12H11Cl2N3O2S — CID 71969137
N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 71969137) has the molecular formula C12H11Cl2N3O2S and a molecular weight of 332.21 g/mol. Its IUPAC name is N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 71969137 |
| Molecular Formula | C12H11Cl2N3O2S |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | N-[2-[(3,5-dichloro-2-pyridinyl)oxy]ethyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)NCCOc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C12H11Cl2N3O2S/c1-7-10(20-6-17-7)11(18)15-2-3-19-12-9(14)4-8(13)5-16-12/h4-6H,2-3H2,1H3,(H,15,18) |
| InChIKey | XETFFZMSLVOMJD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|