C9H14N2OS — CID 110848200
N-butyl-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 110848200) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is N-butyl-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-butyl-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 110848200 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | N-butyl-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCCCNC(=O)c1scnc1C |
| InChI | InChI=1S/C9H14N2OS/c1-3-4-5-10-9(12)8-7(2)11-6-13-8/h6H,3-5H2,1-2H3,(H,10,12) |
| InChIKey | QGWMIFFJMALUFD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|