C7H9N3OS2 — CID 61126703
N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 61126703) has the molecular formula C7H9N3OS2 and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 61126703 |
| Molecular Formula | C7H9N3OS2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)NCC(N)=S |
| InChI | InChI=1S/C7H9N3OS2/c1-4-6(13-3-10-4)7(11)9-2-5(8)12/h3H,2H2,1H3,(H2,8,12)(H,9,11) |
| InChIKey | UTVHWQQUBOQTGO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|