About N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide
N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 61126703) has the molecular formula C7H9N3OS2
and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 61126703 |
| Molecular Formula | C7H9N3OS2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)NCC(N)=S |
| InChI | InChI=1S/C7H9N3OS2/c1-4-6(13-3-10-4)7(11)9-2-5(8)12/h3H,2H2,1H3,(H2,8,12)(H,9,11) |
| InChIKey | UTVHWQQUBOQTGO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide (CID 61126703) is N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide is Cc1ncsc1C(=O)NCC(N)=S.
What is the InChIKey of N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide?
The InChIKey is UTVHWQQUBOQTGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3OS2/c1-4-6(13-3-10-4)7(11)9-2-5(8)12/h3H,2H2,1H3,(H2,8,12)(H,9,11).
What are the key properties of N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide?
N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide has a molecular weight of 215.30 g/mol, XLogP of 0.47, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-2-sulfanylideneethyl)-4-methyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 61126703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).