C13H12N2O2S — CID 64991557
4-methyl-N-phenacyl-1,3-thiazole-5-carboxamide (PubChem CID 64991557) has the molecular formula C13H12N2O2S and a molecular weight of 260.32 g/mol. Its IUPAC name is 4-methyl-N-phenacyl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-phenacyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 64991557 |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 4-methyl-N-phenacyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)NCC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H12N2O2S/c1-9-12(18-8-15-9)13(17)14-7-11(16)10-5-3-2-4-6-10/h2-6,8H,7H2,1H3,(H,14,17) |
| InChIKey | MMGDKCXREYYLHJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |