C9H13N3OS2 — CID 62092045
N-(4-amino-4-sulfanylidenebutan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 62092045) has the molecular formula C9H13N3OS2 and a molecular weight of 243.36 g/mol. Its IUPAC name is N-(4-amino-4-sulfanylidenebutan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 62092045 |
| Molecular Formula | C9H13N3OS2 |
| Molecular Weight | 243.36 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)NC(C)CC(N)=S |
| InChI | InChI=1S/C9H13N3OS2/c1-5(3-7(10)14)12-9(13)8-6(2)11-4-15-8/h4-5H,3H2,1-2H3,(H2,10,14)(H,12,13) |
| InChIKey | NXOFTMKVHDQCFF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|