C10H12BrN3OS — CID 62960438
N-(4-amino-4-sulfanylidenebutan-2-yl)-5-bromopyridine-2-carboxamide (PubChem CID 62960438) has the molecular formula C10H12BrN3OS and a molecular weight of 302.20 g/mol. Its IUPAC name is N-(4-amino-4-sulfanylidenebutan-2-yl)-5-bromopyridine-2-carboxamide.
| Compound Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-5-bromopyridine-2-carboxamide |
|---|---|
| PubChem CID | 62960438 |
| Molecular Formula | C10H12BrN3OS |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-5-bromopyridine-2-carboxamide |
| SMILES | CC(CC(N)=S)NC(=O)c1ccc(Br)cn1 |
| InChI | InChI=1S/C10H12BrN3OS/c1-6(4-9(12)16)14-10(15)8-3-2-7(11)5-13-8/h2-3,5-6H,4H2,1H3,(H2,12,16)(H,14,15) |
| InChIKey | YLJIJBGVZNOFIJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|