C11H12Br2N2OS — CID 114022621
N-(4-amino-4-sulfanylidenebutan-2-yl)-3,5-dibromobenzamide (PubChem CID 114022621) has the molecular formula C11H12Br2N2OS and a molecular weight of 380.11 g/mol. Its IUPAC name is N-(4-amino-4-sulfanylidenebutan-2-yl)-3,5-dibromobenzamide.
| Compound Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-3,5-dibromobenzamide |
|---|---|
| PubChem CID | 114022621 |
| Molecular Formula | C11H12Br2N2OS |
| Molecular Weight | 380.11 g/mol |
| Exact Mass | 377.90 |
| IUPAC Name | N-(4-amino-4-sulfanylidenebutan-2-yl)-3,5-dibromobenzamide |
| SMILES | CC(CC(N)=S)NC(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C11H12Br2N2OS/c1-6(2-10(14)17)15-11(16)7-3-8(12)5-9(13)4-7/h3-6H,2H2,1H3,(H2,14,17)(H,15,16) |
| InChIKey | LWIFIUPSRPMLON-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.11 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|