C12H15Br2NO — CID 107980064
3,5-dibromo-N-(3-methylbutan-2-yl)benzamide (PubChem CID 107980064) has the molecular formula C12H15Br2NO and a molecular weight of 349.07 g/mol. Its IUPAC name is 3,5-dibromo-N-(3-methylbutan-2-yl)benzamide.
| Compound Name | 3,5-dibromo-N-(3-methylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 107980064 |
| Molecular Formula | C12H15Br2NO |
| Molecular Weight | 349.07 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | 3,5-dibromo-N-(3-methylbutan-2-yl)benzamide |
| SMILES | CC(C)C(C)NC(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C12H15Br2NO/c1-7(2)8(3)15-12(16)9-4-10(13)6-11(14)5-9/h4-8H,1-3H3,(H,15,16) |
| InChIKey | NYFMAHQDWRKFGQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.07 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |