C18H26Br2N2O2 — CID 42908120
2,5-dibromo-1-N,4-N-bis(3-methylbutan-2-yl)benzene-1,4-dicarboxamide (PubChem CID 42908120) has the molecular formula C18H26Br2N2O2 and a molecular weight of 462.23 g/mol. Its IUPAC name is 2,5-dibromo-1-N,4-N-bis(3-methylbutan-2-yl)benzene-1,4-dicarboxamide.
| Compound Name | 2,5-dibromo-1-N,4-N-bis(3-methylbutan-2-yl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 42908120 |
| Molecular Formula | C18H26Br2N2O2 |
| Molecular Weight | 462.23 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 2,5-dibromo-1-N,4-N-bis(3-methylbutan-2-yl)benzene-1,4-dicarboxamide |
| SMILES | CC(C)C(C)NC(=O)c1cc(Br)c(C(=O)NC(C)C(C)C)cc1Br |
| InChI | InChI=1S/C18H26Br2N2O2/c1-9(2)11(5)21-17(23)13-7-16(20)14(8-15(13)19)18(24)22-12(6)10(3)4/h7-12H,1-6H3,(H,21,23)(H,22,24) |
| InChIKey | UDXCQNOJQVXREW-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.23 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |