C10H13Cl2NOS — CID 17409200
2,5-dichloro-N-(3-methylbutan-2-yl)thiophene-3-carboxamide (PubChem CID 17409200) has the molecular formula C10H13Cl2NOS and a molecular weight of 266.19 g/mol. Its IUPAC name is 2,5-dichloro-N-(3-methylbutan-2-yl)thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-(3-methylbutan-2-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 17409200 |
| Molecular Formula | C10H13Cl2NOS |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 2,5-dichloro-N-(3-methylbutan-2-yl)thiophene-3-carboxamide |
| SMILES | CC(C)C(C)NC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C10H13Cl2NOS/c1-5(2)6(3)13-10(14)7-4-8(11)15-9(7)12/h4-6H,1-3H3,(H,13,14) |
| InChIKey | TULMJWPDSXYSAZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |