C9H11Cl2N3O2S — CID 107965162
N-[(4Z)-4-amino-4-hydroxyiminobutan-2-yl]-2,5-dichlorothiophene-3-carboxamide (PubChem CID 107965162) has the molecular formula C9H11Cl2N3O2S and a molecular weight of 296.18 g/mol. Its IUPAC name is N-[(4Z)-4-amino-4-hydroxyiminobutan-2-yl]-2,5-dichlorothiophene-3-carboxamide.
| Compound Name | N-[(4Z)-4-amino-4-hydroxyiminobutan-2-yl]-2,5-dichlorothiophene-3-carboxamide |
|---|---|
| PubChem CID | 107965162 |
| Molecular Formula | C9H11Cl2N3O2S |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | N-[(4Z)-4-amino-4-hydroxyiminobutan-2-yl]-2,5-dichlorothiophene-3-carboxamide |
| SMILES | CC(C/C(N)=N/O)NC(=O)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H11Cl2N3O2S/c1-4(2-7(12)14-16)13-9(15)5-3-6(10)17-8(5)11/h3-4,16H,2H2,1H3,(H2,12,14)(H,13,15) |
| InChIKey | VDHIBEAGMBGBGV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|