C11H12F3N3O2 — CID 77056022
N-(4-amino-4-hydroxyiminobutan-2-yl)-2,4,6-trifluorobenzamide (PubChem CID 77056022) has the molecular formula C11H12F3N3O2 and a molecular weight of 275.23 g/mol. Its IUPAC name is N-(4-amino-4-hydroxyiminobutan-2-yl)-2,4,6-trifluorobenzamide.
| Compound Name | N-(4-amino-4-hydroxyiminobutan-2-yl)-2,4,6-trifluorobenzamide |
|---|---|
| PubChem CID | 77056022 |
| Molecular Formula | C11H12F3N3O2 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | N-(4-amino-4-hydroxyiminobutan-2-yl)-2,4,6-trifluorobenzamide |
| SMILES | CC(CC(N)=NO)NC(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C11H12F3N3O2/c1-5(2-9(15)17-19)16-11(18)10-7(13)3-6(12)4-8(10)14/h3-5,19H,2H2,1H3,(H2,15,17)(H,16,18) |
| InChIKey | VNUNUWUPUGLAGP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|