C12H11F3N2O4 — CID 65101287
(2S)-5-amino-5-oxo-2-[(2,4,6-trifluorobenzoyl)amino]pentanoic acid (PubChem CID 65101287) has the molecular formula C12H11F3N2O4 and a molecular weight of 304.22 g/mol. Its IUPAC name is (2S)-5-amino-5-oxo-2-[(2,4,6-trifluorobenzoyl)amino]pentanoic acid.
| Compound Name | (2S)-5-amino-5-oxo-2-[(2,4,6-trifluorobenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 65101287 |
| Molecular Formula | C12H11F3N2O4 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (2S)-5-amino-5-oxo-2-[(2,4,6-trifluorobenzoyl)amino]pentanoic acid |
| SMILES | NC(=O)CC[C@H](NC(=O)c1c(F)cc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C12H11F3N2O4/c13-5-3-6(14)10(7(15)4-5)11(19)17-8(12(20)21)1-2-9(16)18/h3-4,8H,1-2H2,(H2,16,18)(H,17,19)(H,20,21)/t8-/m0/s1 |
| InChIKey | YXYBYMGHSSPMKI-QMMMGPOBSA-N |
| XLogP | 0.55 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |