C12H10F3NO5 — CID 65101239
(2S)-2-[(2,4,6-trifluorobenzoyl)amino]pentanedioic acid (PubChem CID 65101239) has the molecular formula C12H10F3NO5 and a molecular weight of 305.21 g/mol. Its IUPAC name is (2S)-2-[(2,4,6-trifluorobenzoyl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[(2,4,6-trifluorobenzoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 65101239 |
| Molecular Formula | C12H10F3NO5 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | (2S)-2-[(2,4,6-trifluorobenzoyl)amino]pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)c1c(F)cc(F)cc1F)C(=O)O |
| InChI | InChI=1S/C12H10F3NO5/c13-5-3-6(14)10(7(15)4-5)11(19)16-8(12(20)21)1-2-9(17)18/h3-4,8H,1-2H2,(H,16,19)(H,17,18)(H,20,21)/t8-/m0/s1 |
| InChIKey | CPQGWCYTKRIMKY-QMMMGPOBSA-N |
| XLogP | 1.15 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |