C11H10BrF2NO3S — CID 114212487
2-[(4-bromo-2,6-difluorobenzoyl)amino]-4-sulfanylbutanoic acid (PubChem CID 114212487) has the molecular formula C11H10BrF2NO3S and a molecular weight of 354.17 g/mol. Its IUPAC name is 2-[(4-bromo-2,6-difluorobenzoyl)amino]-4-sulfanylbutanoic acid.
| Compound Name | 2-[(4-bromo-2,6-difluorobenzoyl)amino]-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 114212487 |
| Molecular Formula | C11H10BrF2NO3S |
| Molecular Weight | 354.17 g/mol |
| Exact Mass | 352.95 |
| IUPAC Name | 2-[(4-bromo-2,6-difluorobenzoyl)amino]-4-sulfanylbutanoic acid |
| SMILES | O=C(NC(CCS)C(=O)O)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C11H10BrF2NO3S/c12-5-3-6(13)9(7(14)4-5)10(16)15-8(1-2-19)11(17)18/h3-4,8,19H,1-2H2,(H,15,16)(H,17,18) |
| InChIKey | JDLMECBGKONJOG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.17 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|