C11H12FNO3S — CID 142708958
(2S)-2-[(2-fluorobenzoyl)amino]-4-sulfanylbutanoic acid (PubChem CID 142708958) has the molecular formula C11H12FNO3S and a molecular weight of 257.29 g/mol. Its IUPAC name is (2S)-2-[(2-fluorobenzoyl)amino]-4-sulfanylbutanoic acid.
| Compound Name | (2S)-2-[(2-fluorobenzoyl)amino]-4-sulfanylbutanoic acid |
|---|---|
| PubChem CID | 142708958 |
| Molecular Formula | C11H12FNO3S |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (2S)-2-[(2-fluorobenzoyl)amino]-4-sulfanylbutanoic acid |
| SMILES | O=C(N[C@@H](CCS)C(=O)O)c1ccccc1F |
| InChI | InChI=1S/C11H12FNO3S/c12-8-4-2-1-3-7(8)10(14)13-9(5-6-17)11(15)16/h1-4,9,17H,5-6H2,(H,13,14)(H,15,16)/t9-/m0/s1 |
| InChIKey | INFMILTXIBLFOP-VIFPVBQESA-N |
| XLogP | 1.33 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|