C10H10ClNO3S — CID 142708990
(2R)-2-[(2-chlorobenzoyl)amino]-3-sulfanylpropanoic acid (PubChem CID 142708990) has the molecular formula C10H10ClNO3S and a molecular weight of 259.71 g/mol. Its IUPAC name is (2R)-2-[(2-chlorobenzoyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-[(2-chlorobenzoyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 142708990 |
| Molecular Formula | C10H10ClNO3S |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | (2R)-2-[(2-chlorobenzoyl)amino]-3-sulfanylpropanoic acid |
| SMILES | O=C(N[C@@H](CS)C(=O)O)c1ccccc1Cl |
| InChI | InChI=1S/C10H10ClNO3S/c11-7-4-2-1-3-6(7)9(13)12-8(5-16)10(14)15/h1-4,8,16H,5H2,(H,12,13)(H,14,15)/t8-/m0/s1 |
| InChIKey | HEJFLGXDXXJNAA-QMMMGPOBSA-N |
| XLogP | 1.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|