C16H15NO3S — CID 87373520
2-[(2-phenylbenzoyl)amino]-3-sulfanylpropanoic acid (PubChem CID 87373520) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-[(2-phenylbenzoyl)amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[(2-phenylbenzoyl)amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87373520 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 2-[(2-phenylbenzoyl)amino]-3-sulfanylpropanoic acid |
| SMILES | O=C(NC(CS)C(=O)O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C16H15NO3S/c18-15(17-14(10-21)16(19)20)13-9-5-4-8-12(13)11-6-2-1-3-7-11/h1-9,14,21H,10H2,(H,17,18)(H,19,20) |
| InChIKey | UVZPASQBFJKAFR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|