C19H19NO4S — CID 141263868
2-[[1,3-dioxo-1-(2-phenylphenyl)butan-2-yl]amino]-3-sulfanylpropanoic acid (PubChem CID 141263868) has the molecular formula C19H19NO4S and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-[[1,3-dioxo-1-(2-phenylphenyl)butan-2-yl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[1,3-dioxo-1-(2-phenylphenyl)butan-2-yl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 141263868 |
| Molecular Formula | C19H19NO4S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-[[1,3-dioxo-1-(2-phenylphenyl)butan-2-yl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(=O)C(NC(CS)C(=O)O)C(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C19H19NO4S/c1-12(21)17(20-16(11-25)19(23)24)18(22)15-10-6-5-9-14(15)13-7-3-2-4-8-13/h2-10,16-17,20,25H,11H2,1H3,(H,23,24) |
| InChIKey | MHYAXEUZMDBZCD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|