About (2R)-2-anilino-3-sulfanylpropanoic acid;hydrobromide
(2R)-2-anilino-3-sulfanylpropanoic acid;hydrobromide (PubChem CID 71352258) has the molecular formula C9H12BrNO2S
and a molecular weight of 278.17 g/mol. Its IUPAC name is (2R)-2-anilino-3-sulfanylpropanoic acid;hydrobromide.
Molecular Properties
| Compound Name | (2R)-2-anilino-3-sulfanylpropanoic acid;hydrobromide |
| PubChem CID | 71352258 |
| Molecular Formula | C9H12BrNO2S |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | (2R)-2-anilino-3-sulfanylpropanoic acid;hydrobromide |
| SMILES | Br.O=C(O)[C@H](CS)Nc1ccccc1 |
| InChI | InChI=1S/C9H11NO2S.BrH/c11-9(12)8(6-13)10-7-4-2-1-3-5-7;/h1-5,8,10,13H,6H2,(H,11,12);1H/t8-;/m0./s1 |
| InChIKey | NGFAVQVWBOQNDE-QRPNPIFTSA-N |
| XLogP | 2.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-anilino-3-sulfanylpropanoic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-anilino-3-sulfanylpropanoic acid;hydrobromide?
The IUPAC name of (2R)-2-anilino-3-sulfanylpropanoic acid;hydrobromide (CID 71352258) is (2R)-2-anilino-3-sulfanylpropanoic acid;hydrobromide.
What is the SMILES notation for (2R)-2-anilino-3-sulfanylpropanoic acid;hydrobromide?
The canonical SMILES for (2R)-2-anilino-3-sulfanylpropanoic acid;hydrobromide is Br.O=C(O)[C@H](CS)Nc1ccccc1.
What is the InChIKey of (2R)-2-anilino-3-sulfanylpropanoic acid;hydrobromide?
The InChIKey is NGFAVQVWBOQNDE-QRPNPIFTSA-N. The full InChI is InChI=1S/C9H11NO2S.BrH/c11-9(12)8(6-13)10-7-4-2-1-3-5-7;/h1-5,8,10,13H,6H2,(H,11,12);1H/t8-;/m0./s1.
What are the key properties of (2R)-2-anilino-3-sulfanylpropanoic acid;hydrobromide?
(2R)-2-anilino-3-sulfanylpropanoic acid;hydrobromide has a molecular weight of 278.17 g/mol, XLogP of 2.06, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-anilino-3-sulfanylpropanoic acid;hydrobromide is sourced from PubChem (CID 71352258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).