C9H14ClNO6S2 — CID 175420223
2-anilino-3-sulfanylpropanoic acid;sulfuric acid;hydrochloride (PubChem CID 175420223) has the molecular formula C9H14ClNO6S2 and a molecular weight of 331.80 g/mol. Its IUPAC name is 2-anilino-3-sulfanylpropanoic acid;sulfuric acid;hydrochloride.
| Compound Name | 2-anilino-3-sulfanylpropanoic acid;sulfuric acid;hydrochloride |
|---|---|
| PubChem CID | 175420223 |
| Molecular Formula | C9H14ClNO6S2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | 2-anilino-3-sulfanylpropanoic acid;sulfuric acid;hydrochloride |
| SMILES | Cl.O=C(O)C(CS)Nc1ccccc1.O=S(=O)(O)O |
| InChI | InChI=1S/C9H11NO2S.ClH.H2O4S/c11-9(12)8(6-13)10-7-4-2-1-3-5-7;;1-5(2,3)4/h1-5,8,10,13H,6H2,(H,11,12);1H;(H2,1,2,3,4) |
| InChIKey | DIUDIFCCVMKWMP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|